About 4-(2-azidoethyl)benzoic acid
4-(2-azidoethyl)benzoic acid (PubChem CID 19809169) has the molecular formula C9H9N3O2
and a molecular weight of 191.19 g/mol. Its IUPAC name is 4-(2-azidoethyl)benzoic acid.
Molecular Properties
| Compound Name | 4-(2-azidoethyl)benzoic acid |
| PubChem CID | 19809169 |
| Molecular Formula | C9H9N3O2 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | 4-(2-azidoethyl)benzoic acid |
| SMILES | [N-]=[N+]=NCCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C9H9N3O2/c10-12-11-6-5-7-1-3-8(4-2-7)9(13)14/h1-4H,5-6H2,(H,13,14) |
| InChIKey | DACAHPMWSDRMFE-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 86.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-azidoethyl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-azidoethyl)benzoic acid?
The IUPAC name of 4-(2-azidoethyl)benzoic acid (CID 19809169) is 4-(2-azidoethyl)benzoic acid.
What is the SMILES notation for 4-(2-azidoethyl)benzoic acid?
The canonical SMILES for 4-(2-azidoethyl)benzoic acid is [N-]=[N+]=NCCc1ccc(C(=O)O)cc1.
What is the InChIKey of 4-(2-azidoethyl)benzoic acid?
The InChIKey is DACAHPMWSDRMFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O2/c10-12-11-6-5-7-1-3-8(4-2-7)9(13)14/h1-4H,5-6H2,(H,13,14).
What are the key properties of 4-(2-azidoethyl)benzoic acid?
4-(2-azidoethyl)benzoic acid has a molecular weight of 191.19 g/mol, XLogP of 2.24, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-azidoethyl)benzoic acid is sourced from PubChem (CID 19809169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).