About 5-amino-2-[2,5-bis(2-hydroxyethylsulfonylmethyl)anilino]benzenesulfonic acid
5-amino-2-[2,5-bis(2-hydroxyethylsulfonylmethyl)anilino]benzenesulfonic acid (PubChem CID 19809348) has the molecular formula C18H24N2O9S3
and a molecular weight of 508.60 g/mol. Its IUPAC name is 5-amino-2-[2,5-bis(2-hydroxyethylsulfonylmethyl)anilino]benzenesulfonic acid.
Molecular Properties
| Compound Name | 5-amino-2-[2,5-bis(2-hydroxyethylsulfonylmethyl)anilino]benzenesulfonic acid |
| PubChem CID | 19809348 |
| Molecular Formula | C18H24N2O9S3 |
| Molecular Weight | 508.60 g/mol |
| Exact Mass | 508.06 |
| IUPAC Name | 5-amino-2-[2,5-bis(2-hydroxyethylsulfonylmethyl)anilino]benzenesulfonic acid |
| SMILES | Nc1ccc(Nc2cc(CS(=O)(=O)CCO)ccc2CS(=O)(=O)CCO)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C18H24N2O9S3/c19-15-3-4-16(18(10-15)32(27,28)29)20-17-9-13(11-30(23,24)7-5-21)1-2-14(17)12-31(25,26)8-6-22/h1-4,9-10,20-22H,5-8,11-12,19H2,(H,27,28,29) |
| InChIKey | RUHWZUODUQSPEY-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 201.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 508.60 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-2-[2,5-bis(2-hydroxyethylsulfonylmethyl)anilino]benzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2-[2,5-bis(2-hydroxyethylsulfonylmethyl)anilino]benzenesulfonic acid?
The IUPAC name of 5-amino-2-[2,5-bis(2-hydroxyethylsulfonylmethyl)anilino]benzenesulfonic acid (CID 19809348) is 5-amino-2-[2,5-bis(2-hydroxyethylsulfonylmethyl)anilino]benzenesulfonic acid.
What is the SMILES notation for 5-amino-2-[2,5-bis(2-hydroxyethylsulfonylmethyl)anilino]benzenesulfonic acid?
The canonical SMILES for 5-amino-2-[2,5-bis(2-hydroxyethylsulfonylmethyl)anilino]benzenesulfonic acid is Nc1ccc(Nc2cc(CS(=O)(=O)CCO)ccc2CS(=O)(=O)CCO)c(S(=O)(=O)O)c1.
What is the InChIKey of 5-amino-2-[2,5-bis(2-hydroxyethylsulfonylmethyl)anilino]benzenesulfonic acid?
The InChIKey is RUHWZUODUQSPEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N2O9S3/c19-15-3-4-16(18(10-15)32(27,28)29)20-17-9-13(11-30(23,24)7-5-21)1-2-14(17)12-31(25,26)8-6-22/h1-4,9-10,20-22H,5-8,11-12,19H2,(H,27,28,29).
What are the key properties of 5-amino-2-[2,5-bis(2-hydroxyethylsulfonylmethyl)anilino]benzenesulfonic acid?
5-amino-2-[2,5-bis(2-hydroxyethylsulfonylmethyl)anilino]benzenesulfonic acid has a molecular weight of 508.60 g/mol, XLogP of 0.07, 11 rotatable bonds, 5 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2-[2,5-bis(2-hydroxyethylsulfonylmethyl)anilino]benzenesulfonic acid is sourced from PubChem (CID 19809348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).