C17H30O2P+ — CID 19809616
hydroxy-oxo-[(4E,8E)-5,9,13-trimethyltetradeca-4,8,12-trienyl]phosphanium (PubChem CID 19809616) has the molecular formula C17H30O2P+ and a molecular weight of 297.40 g/mol. Its IUPAC name is hydroxy-oxo-[(4E,8E)-5,9,13-trimethyltetradeca-4,8,12-trienyl]phosphanium.
| Compound Name | hydroxy-oxo-[(4E,8E)-5,9,13-trimethyltetradeca-4,8,12-trienyl]phosphanium |
|---|---|
| PubChem CID | 19809616 |
| Molecular Formula | C17H30O2P+ |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.20 |
| IUPAC Name | hydroxy-oxo-[(4E,8E)-5,9,13-trimethyltetradeca-4,8,12-trienyl]phosphanium |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CCC[P+](=O)O |
| InChI | InChI=1S/C17H29O2P/c1-15(2)9-7-11-17(4)13-8-12-16(3)10-5-6-14-20(18)19/h9-10,13H,5-8,11-12,14H2,1-4H3/p+1/b16-10+,17-13+ |
| InChIKey | DBMJQLCHDYXKNZ-QKXOVSGLSA-O |
| XLogP | 5.92 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|