About 1-[1-(3,3-dimethylcyclopentyl)ethoxy]propan-2-yl propanoate
1-[1-(3,3-dimethylcyclopentyl)ethoxy]propan-2-yl propanoate (PubChem CID 19809723) has the molecular formula C15H28O3
and a molecular weight of 256.39 g/mol. Its IUPAC name is 1-[1-(3,3-dimethylcyclopentyl)ethoxy]propan-2-yl propanoate.
Molecular Properties
| Compound Name | 1-[1-(3,3-dimethylcyclopentyl)ethoxy]propan-2-yl propanoate |
| PubChem CID | 19809723 |
| Molecular Formula | C15H28O3 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | 1-[1-(3,3-dimethylcyclopentyl)ethoxy]propan-2-yl propanoate |
| SMILES | CCC(=O)OC(C)COC(C)C1CCC(C)(C)C1 |
| InChI | InChI=1S/C15H28O3/c1-6-14(16)18-11(2)10-17-12(3)13-7-8-15(4,5)9-13/h11-13H,6-10H2,1-5H3 |
| InChIKey | BNCYPPKNYIAGBM-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[1-(3,3-dimethylcyclopentyl)ethoxy]propan-2-yl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(3,3-dimethylcyclopentyl)ethoxy]propan-2-yl propanoate?
The IUPAC name of 1-[1-(3,3-dimethylcyclopentyl)ethoxy]propan-2-yl propanoate (CID 19809723) is 1-[1-(3,3-dimethylcyclopentyl)ethoxy]propan-2-yl propanoate.
What is the SMILES notation for 1-[1-(3,3-dimethylcyclopentyl)ethoxy]propan-2-yl propanoate?
The canonical SMILES for 1-[1-(3,3-dimethylcyclopentyl)ethoxy]propan-2-yl propanoate is CCC(=O)OC(C)COC(C)C1CCC(C)(C)C1.
What is the InChIKey of 1-[1-(3,3-dimethylcyclopentyl)ethoxy]propan-2-yl propanoate?
The InChIKey is BNCYPPKNYIAGBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28O3/c1-6-14(16)18-11(2)10-17-12(3)13-7-8-15(4,5)9-13/h11-13H,6-10H2,1-5H3.
What are the key properties of 1-[1-(3,3-dimethylcyclopentyl)ethoxy]propan-2-yl propanoate?
1-[1-(3,3-dimethylcyclopentyl)ethoxy]propan-2-yl propanoate has a molecular weight of 256.39 g/mol, XLogP of 3.56, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(3,3-dimethylcyclopentyl)ethoxy]propan-2-yl propanoate is sourced from PubChem (CID 19809723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).