C4H3Cl3N2 — CID 19809821
2,4,5-trichloro-1,4-dihydropyrimidine (PubChem CID 19809821) has the molecular formula C4H3Cl3N2 and a molecular weight of 185.44 g/mol. Its IUPAC name is 2,4,5-trichloro-1,4-dihydropyrimidine.
| Compound Name | 2,4,5-trichloro-1,4-dihydropyrimidine |
|---|---|
| PubChem CID | 19809821 |
| Molecular Formula | C4H3Cl3N2 |
| Molecular Weight | 185.44 g/mol |
| Exact Mass | 183.94 |
| IUPAC Name | 2,4,5-trichloro-1,4-dihydropyrimidine |
| SMILES | ClC1=CNC(Cl)=NC1Cl |
| InChI | InChI=1S/C4H3Cl3N2/c5-2-1-8-4(7)9-3(2)6/h1,3H,(H,8,9) |
| InChIKey | DTUMMMPRNQOUEW-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.44 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|