About 2,3-dihydro-4,1-benzothiazepine;hydrobromide
2,3-dihydro-4,1-benzothiazepine;hydrobromide (PubChem CID 19810499) has the molecular formula C9H10BrNS
and a molecular weight of 244.16 g/mol. Its IUPAC name is 2,3-dihydro-4,1-benzothiazepine;hydrobromide.
Molecular Properties
| Compound Name | 2,3-dihydro-4,1-benzothiazepine;hydrobromide |
| PubChem CID | 19810499 |
| Molecular Formula | C9H10BrNS |
| Molecular Weight | 244.16 g/mol |
| Exact Mass | 242.97 |
| IUPAC Name | 2,3-dihydro-4,1-benzothiazepine;hydrobromide |
| SMILES | Br.C1=c2ccccc2=NCCS1 |
| InChI | InChI=1S/C9H9NS.BrH/c1-2-4-9-8(3-1)7-11-6-5-10-9;/h1-4,7H,5-6H2;1H |
| InChIKey | OIFHXUNUHKPKHS-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.16 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3-dihydro-4,1-benzothiazepine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-4,1-benzothiazepine;hydrobromide?
The IUPAC name of 2,3-dihydro-4,1-benzothiazepine;hydrobromide (CID 19810499) is 2,3-dihydro-4,1-benzothiazepine;hydrobromide.
What is the SMILES notation for 2,3-dihydro-4,1-benzothiazepine;hydrobromide?
The canonical SMILES for 2,3-dihydro-4,1-benzothiazepine;hydrobromide is Br.C1=c2ccccc2=NCCS1.
What is the InChIKey of 2,3-dihydro-4,1-benzothiazepine;hydrobromide?
The InChIKey is OIFHXUNUHKPKHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NS.BrH/c1-2-4-9-8(3-1)7-11-6-5-10-9;/h1-4,7H,5-6H2;1H.
What are the key properties of 2,3-dihydro-4,1-benzothiazepine;hydrobromide?
2,3-dihydro-4,1-benzothiazepine;hydrobromide has a molecular weight of 244.16 g/mol, XLogP of 1.37, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-4,1-benzothiazepine;hydrobromide is sourced from PubChem (CID 19810499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).