C17H15F3N2O4 — CID 19810643
5-acetyl-1-(cyclopropylmethyl)-3-[3-(trifluoromethyl)phenyl]-1,3-diazinane-2,4,6-trione (PubChem CID 19810643) has the molecular formula C17H15F3N2O4 and a molecular weight of 368.31 g/mol. Its IUPAC name is 5-acetyl-1-(cyclopropylmethyl)-3-[3-(trifluoromethyl)phenyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-acetyl-1-(cyclopropylmethyl)-3-[3-(trifluoromethyl)phenyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 19810643 |
| Molecular Formula | C17H15F3N2O4 |
| Molecular Weight | 368.31 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | 5-acetyl-1-(cyclopropylmethyl)-3-[3-(trifluoromethyl)phenyl]-1,3-diazinane-2,4,6-trione |
| SMILES | CC(=O)C1C(=O)N(CC2CC2)C(=O)N(c2cccc(C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C17H15F3N2O4/c1-9(23)13-14(24)21(8-10-5-6-10)16(26)22(15(13)25)12-4-2-3-11(7-12)17(18,19)20/h2-4,7,10,13H,5-6,8H2,1H3 |
| InChIKey | VSDAERAULGIMHU-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|