C16H14F2N2O4 — CID 19810650
5-acetyl-1-(cyclopropylmethyl)-3-(2,6-difluorophenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 19810650) has the molecular formula C16H14F2N2O4 and a molecular weight of 336.29 g/mol. Its IUPAC name is 5-acetyl-1-(cyclopropylmethyl)-3-(2,6-difluorophenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-acetyl-1-(cyclopropylmethyl)-3-(2,6-difluorophenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 19810650 |
| Molecular Formula | C16H14F2N2O4 |
| Molecular Weight | 336.29 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 5-acetyl-1-(cyclopropylmethyl)-3-(2,6-difluorophenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | CC(=O)C1C(=O)N(CC2CC2)C(=O)N(c2c(F)cccc2F)C1=O |
| InChI | InChI=1S/C16H14F2N2O4/c1-8(21)12-14(22)19(7-9-5-6-9)16(24)20(15(12)23)13-10(17)3-2-4-11(13)18/h2-4,9,12H,5-7H2,1H3 |
| InChIKey | TWATWAQJMIUCBK-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.29 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|