C13H22N2 — CID 19810742
4-N',4-N'-bis(prop-2-enyl)hepta-1,6-diene-4,4-diamine (PubChem CID 19810742) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is 4-N',4-N'-bis(prop-2-enyl)hepta-1,6-diene-4,4-diamine.
| Compound Name | 4-N',4-N'-bis(prop-2-enyl)hepta-1,6-diene-4,4-diamine |
|---|---|
| PubChem CID | 19810742 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 4-N',4-N'-bis(prop-2-enyl)hepta-1,6-diene-4,4-diamine |
| SMILES | C=CCN(CC=C)C(N)(CC=C)CC=C |
| InChI | InChI=1S/C13H22N2/c1-5-9-13(14,10-6-2)15(11-7-3)12-8-4/h5-8H,1-4,9-12,14H2 |
| InChIKey | XDYNIUQLIQJYNM-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|