About hexan-2-yl formate
hexan-2-yl formate (PubChem CID 19810807) has the molecular formula C7H14O2
and a molecular weight of 130.19 g/mol. Its IUPAC name is hexan-2-yl formate.
Molecular Properties
| Compound Name | hexan-2-yl formate |
| PubChem CID | 19810807 |
| Molecular Formula | C7H14O2 |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.10 |
| IUPAC Name | hexan-2-yl formate |
| SMILES | CCCCC(C)OC=O |
| InChI | InChI=1S/C7H14O2/c1-3-4-5-7(2)9-6-8/h6-7H,3-5H2,1-2H3 |
| InChIKey | AQEFOGUXEVXUCT-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze hexan-2-yl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexan-2-yl formate?
The IUPAC name of hexan-2-yl formate (CID 19810807) is hexan-2-yl formate.
What is the SMILES notation for hexan-2-yl formate?
The canonical SMILES for hexan-2-yl formate is CCCCC(C)OC=O.
What is the InChIKey of hexan-2-yl formate?
The InChIKey is AQEFOGUXEVXUCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O2/c1-3-4-5-7(2)9-6-8/h6-7H,3-5H2,1-2H3.
What are the key properties of hexan-2-yl formate?
hexan-2-yl formate has a molecular weight of 130.19 g/mol, XLogP of 1.74, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hexan-2-yl formate is sourced from PubChem (CID 19810807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).