About 3,8-dimethyl-1,6-dioxaspiro[4.4]nonane-2,7-dione
3,8-dimethyl-1,6-dioxaspiro[4.4]nonane-2,7-dione (PubChem CID 19810828) has the molecular formula C9H12O4
and a molecular weight of 184.19 g/mol. Its IUPAC name is 3,8-dimethyl-1,6-dioxaspiro[4.4]nonane-2,7-dione.
Molecular Properties
| Compound Name | 3,8-dimethyl-1,6-dioxaspiro[4.4]nonane-2,7-dione |
| PubChem CID | 19810828 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 3,8-dimethyl-1,6-dioxaspiro[4.4]nonane-2,7-dione |
| SMILES | CC1CC2(CC(C)C(=O)O2)OC1=O |
| InChI | InChI=1S/C9H12O4/c1-5-3-9(12-7(5)10)4-6(2)8(11)13-9/h5-6H,3-4H2,1-2H3 |
| InChIKey | SUXLSKBZCREADW-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,8-dimethyl-1,6-dioxaspiro[4.4]nonane-2,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,8-dimethyl-1,6-dioxaspiro[4.4]nonane-2,7-dione?
The IUPAC name of 3,8-dimethyl-1,6-dioxaspiro[4.4]nonane-2,7-dione (CID 19810828) is 3,8-dimethyl-1,6-dioxaspiro[4.4]nonane-2,7-dione.
What is the SMILES notation for 3,8-dimethyl-1,6-dioxaspiro[4.4]nonane-2,7-dione?
The canonical SMILES for 3,8-dimethyl-1,6-dioxaspiro[4.4]nonane-2,7-dione is CC1CC2(CC(C)C(=O)O2)OC1=O.
What is the InChIKey of 3,8-dimethyl-1,6-dioxaspiro[4.4]nonane-2,7-dione?
The InChIKey is SUXLSKBZCREADW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O4/c1-5-3-9(12-7(5)10)4-6(2)8(11)13-9/h5-6H,3-4H2,1-2H3.
What are the key properties of 3,8-dimethyl-1,6-dioxaspiro[4.4]nonane-2,7-dione?
3,8-dimethyl-1,6-dioxaspiro[4.4]nonane-2,7-dione has a molecular weight of 184.19 g/mol, XLogP of 0.85, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,8-dimethyl-1,6-dioxaspiro[4.4]nonane-2,7-dione is sourced from PubChem (CID 19810828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).