About (1-benzyl-3,6-dihydro-2H-pyridin-4-yl)oxy-trimethylsilane
(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)oxy-trimethylsilane (PubChem CID 19810871) has the molecular formula C15H23NOSi
and a molecular weight of 261.44 g/mol. Its IUPAC name is (1-benzyl-3,6-dihydro-2H-pyridin-4-yl)oxy-trimethylsilane.
Molecular Properties
| Compound Name | (1-benzyl-3,6-dihydro-2H-pyridin-4-yl)oxy-trimethylsilane |
| PubChem CID | 19810871 |
| Molecular Formula | C15H23NOSi |
| Molecular Weight | 261.44 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | (1-benzyl-3,6-dihydro-2H-pyridin-4-yl)oxy-trimethylsilane |
| SMILES | C[Si](C)(C)OC1=CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C15H23NOSi/c1-18(2,3)17-15-9-11-16(12-10-15)13-14-7-5-4-6-8-14/h4-9H,10-13H2,1-3H3 |
| InChIKey | AIDNSPBEIPJBOU-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.44 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (1-benzyl-3,6-dihydro-2H-pyridin-4-yl)oxy-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-benzyl-3,6-dihydro-2H-pyridin-4-yl)oxy-trimethylsilane?
The IUPAC name of (1-benzyl-3,6-dihydro-2H-pyridin-4-yl)oxy-trimethylsilane (CID 19810871) is (1-benzyl-3,6-dihydro-2H-pyridin-4-yl)oxy-trimethylsilane.
What is the SMILES notation for (1-benzyl-3,6-dihydro-2H-pyridin-4-yl)oxy-trimethylsilane?
The canonical SMILES for (1-benzyl-3,6-dihydro-2H-pyridin-4-yl)oxy-trimethylsilane is C[Si](C)(C)OC1=CCN(Cc2ccccc2)CC1.
What is the InChIKey of (1-benzyl-3,6-dihydro-2H-pyridin-4-yl)oxy-trimethylsilane?
The InChIKey is AIDNSPBEIPJBOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NOSi/c1-18(2,3)17-15-9-11-16(12-10-15)13-14-7-5-4-6-8-14/h4-9H,10-13H2,1-3H3.
What are the key properties of (1-benzyl-3,6-dihydro-2H-pyridin-4-yl)oxy-trimethylsilane?
(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)oxy-trimethylsilane has a molecular weight of 261.44 g/mol, XLogP of 3.63, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-benzyl-3,6-dihydro-2H-pyridin-4-yl)oxy-trimethylsilane is sourced from PubChem (CID 19810871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).