C18H20FNO4 — CID 19810935
ethyl 4-(4-fluorophenyl)-5-(hydroxymethyl)-6-oxo-2-propan-2-yl-1H-pyridine-3-carboxylate (PubChem CID 19810935) has the molecular formula C18H20FNO4 and a molecular weight of 333.36 g/mol. Its IUPAC name is ethyl 4-(4-fluorophenyl)-5-(hydroxymethyl)-6-oxo-2-propan-2-yl-1H-pyridine-3-carboxylate.
| Compound Name | ethyl 4-(4-fluorophenyl)-5-(hydroxymethyl)-6-oxo-2-propan-2-yl-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 19810935 |
| Molecular Formula | C18H20FNO4 |
| Molecular Weight | 333.36 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | ethyl 4-(4-fluorophenyl)-5-(hydroxymethyl)-6-oxo-2-propan-2-yl-1H-pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(C(C)C)[nH]c(=O)c(CO)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C18H20FNO4/c1-4-24-18(23)15-14(11-5-7-12(19)8-6-11)13(9-21)17(22)20-16(15)10(2)3/h5-8,10,21H,4,9H2,1-3H3,(H,20,22) |
| InChIKey | YONGUDLZFJLESE-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.36 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |