C35H47N5O2 — CID 19810971
4-[4,5-bis[4-(diethylamino)phenyl]-1H-imidazol-2-yl]-N,N-diethyl-2,6-dimethoxyaniline (PubChem CID 19810971) has the molecular formula C35H47N5O2 and a molecular weight of 569.79 g/mol. Its IUPAC name is 4-[4,5-bis[4-(diethylamino)phenyl]-1H-imidazol-2-yl]-N,N-diethyl-2,6-dimethoxyaniline.
| Compound Name | 4-[4,5-bis[4-(diethylamino)phenyl]-1H-imidazol-2-yl]-N,N-diethyl-2,6-dimethoxyaniline |
|---|---|
| PubChem CID | 19810971 |
| Molecular Formula | C35H47N5O2 |
| Molecular Weight | 569.79 g/mol |
| Exact Mass | 569.37 |
| IUPAC Name | 4-[4,5-bis[4-(diethylamino)phenyl]-1H-imidazol-2-yl]-N,N-diethyl-2,6-dimethoxyaniline |
| SMILES | CCN(CC)c1ccc(-c2nc(-c3cc(OC)c(N(CC)CC)c(OC)c3)[nH]c2-c2ccc(N(CC)CC)cc2)cc1 |
| InChI | InChI=1S/C35H47N5O2/c1-9-38(10-2)28-19-15-25(16-20-28)32-33(26-17-21-29(22-18-26)39(11-3)12-4)37-35(36-32)27-23-30(41-7)34(31(24-27)42-8)40(13-5)14-6/h15-24H,9-14H2,1-8H3,(H,36,37) |
| InChIKey | AYLANTMKJMNDJE-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 56.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.79 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'} |
|---|