About calcium bis(2,2-dimethyl-1,3-dioxolane-4-carboxylate)
calcium bis(2,2-dimethyl-1,3-dioxolane-4-carboxylate) (PubChem CID 19811036) has the molecular formula C12H18CaO8
and a molecular weight of 330.35 g/mol. Its IUPAC name is calcium bis(2,2-dimethyl-1,3-dioxolane-4-carboxylate).
Molecular Properties
| Compound Name | calcium bis(2,2-dimethyl-1,3-dioxolane-4-carboxylate) |
| PubChem CID | 19811036 |
| Molecular Formula | C12H18CaO8 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | calcium bis(2,2-dimethyl-1,3-dioxolane-4-carboxylate) |
| SMILES | CC1(C)OCC(C(=O)[O-])O1.CC1(C)OCC(C(=O)[O-])O1.[Ca+2] |
| InChI | InChI=1S/2C6H10O4.Ca/c2*1-6(2)9-3-4(10-6)5(7)8;/h2*4H,3H2,1-2H3,(H,7,8);/q;;+2/p-2 |
| InChIKey | XMJCTGSEPRPIEL-UHFFFAOYSA-L |
| XLogP | -2.61 |
| TPSA | 117.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | -2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze calcium bis(2,2-dimethyl-1,3-dioxolane-4-carboxylate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium bis(2,2-dimethyl-1,3-dioxolane-4-carboxylate)?
The IUPAC name of calcium bis(2,2-dimethyl-1,3-dioxolane-4-carboxylate) (CID 19811036) is calcium bis(2,2-dimethyl-1,3-dioxolane-4-carboxylate).
What is the SMILES notation for calcium bis(2,2-dimethyl-1,3-dioxolane-4-carboxylate)?
The canonical SMILES for calcium bis(2,2-dimethyl-1,3-dioxolane-4-carboxylate) is CC1(C)OCC(C(=O)[O-])O1.CC1(C)OCC(C(=O)[O-])O1.[Ca+2].
What is the InChIKey of calcium bis(2,2-dimethyl-1,3-dioxolane-4-carboxylate)?
The InChIKey is XMJCTGSEPRPIEL-UHFFFAOYSA-L. The full InChI is InChI=1S/2C6H10O4.Ca/c2*1-6(2)9-3-4(10-6)5(7)8;/h2*4H,3H2,1-2H3,(H,7,8);/q;;+2/p-2.
What are the key properties of calcium bis(2,2-dimethyl-1,3-dioxolane-4-carboxylate)?
calcium bis(2,2-dimethyl-1,3-dioxolane-4-carboxylate) has a molecular weight of 330.35 g/mol, XLogP of -2.61, 2 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for calcium bis(2,2-dimethyl-1,3-dioxolane-4-carboxylate) is sourced from PubChem (CID 19811036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).