About 4-triethylsilylaniline
4-triethylsilylaniline (PubChem CID 19811066) has the molecular formula C12H21NSi
and a molecular weight of 207.39 g/mol. Its IUPAC name is 4-triethylsilylaniline.
Molecular Properties
| Compound Name | 4-triethylsilylaniline |
| PubChem CID | 19811066 |
| Molecular Formula | C12H21NSi |
| Molecular Weight | 207.39 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 4-triethylsilylaniline |
| SMILES | CC[Si](CC)(CC)c1ccc(N)cc1 |
| InChI | InChI=1S/C12H21NSi/c1-4-14(5-2,6-3)12-9-7-11(13)8-10-12/h7-10H,4-6,13H2,1-3H3 |
| InChIKey | VXUYIMVZEPATNL-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.39 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-triethylsilylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-triethylsilylaniline?
The IUPAC name of 4-triethylsilylaniline (CID 19811066) is 4-triethylsilylaniline.
What is the SMILES notation for 4-triethylsilylaniline?
The canonical SMILES for 4-triethylsilylaniline is CC[Si](CC)(CC)c1ccc(N)cc1.
What is the InChIKey of 4-triethylsilylaniline?
The InChIKey is VXUYIMVZEPATNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NSi/c1-4-14(5-2,6-3)12-9-7-11(13)8-10-12/h7-10H,4-6,13H2,1-3H3.
What are the key properties of 4-triethylsilylaniline?
4-triethylsilylaniline has a molecular weight of 207.39 g/mol, XLogP of 2.98, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-triethylsilylaniline is sourced from PubChem (CID 19811066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).