About 1-N,4-N-bis[2-(aziridin-1-yl)ethyl]benzo[g]phthalazine-1,4-diamine
1-N,4-N-bis[2-(aziridin-1-yl)ethyl]benzo[g]phthalazine-1,4-diamine (PubChem CID 19811426) has the molecular formula C20H24N6
and a molecular weight of 348.45 g/mol. Its IUPAC name is 1-N,4-N-bis[2-(aziridin-1-yl)ethyl]benzo[g]phthalazine-1,4-diamine.
Molecular Properties
| Compound Name | 1-N,4-N-bis[2-(aziridin-1-yl)ethyl]benzo[g]phthalazine-1,4-diamine |
| PubChem CID | 19811426 |
| Molecular Formula | C20H24N6 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | 1-N,4-N-bis[2-(aziridin-1-yl)ethyl]benzo[g]phthalazine-1,4-diamine |
| SMILES | c1ccc2cc3c(NCCN4CC4)nnc(NCCN4CC4)c3cc2c1 |
| InChI | InChI=1S/C20H24N6/c1-2-4-16-14-18-17(13-15(16)3-1)19(21-5-7-25-9-10-25)23-24-20(18)22-6-8-26-11-12-26/h1-4,13-14H,5-12H2,(H,21,23)(H,22,24) |
| InChIKey | HPYYNVHDDWFEHU-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 55.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-N,4-N-bis[2-(aziridin-1-yl)ethyl]benzo[g]phthalazine-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,4-N-bis[2-(aziridin-1-yl)ethyl]benzo[g]phthalazine-1,4-diamine?
The IUPAC name of 1-N,4-N-bis[2-(aziridin-1-yl)ethyl]benzo[g]phthalazine-1,4-diamine (CID 19811426) is 1-N,4-N-bis[2-(aziridin-1-yl)ethyl]benzo[g]phthalazine-1,4-diamine.
What is the SMILES notation for 1-N,4-N-bis[2-(aziridin-1-yl)ethyl]benzo[g]phthalazine-1,4-diamine?
The canonical SMILES for 1-N,4-N-bis[2-(aziridin-1-yl)ethyl]benzo[g]phthalazine-1,4-diamine is c1ccc2cc3c(NCCN4CC4)nnc(NCCN4CC4)c3cc2c1.
What is the InChIKey of 1-N,4-N-bis[2-(aziridin-1-yl)ethyl]benzo[g]phthalazine-1,4-diamine?
The InChIKey is HPYYNVHDDWFEHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N6/c1-2-4-16-14-18-17(13-15(16)3-1)19(21-5-7-25-9-10-25)23-24-20(18)22-6-8-26-11-12-26/h1-4,13-14H,5-12H2,(H,21,23)(H,22,24).
What are the key properties of 1-N,4-N-bis[2-(aziridin-1-yl)ethyl]benzo[g]phthalazine-1,4-diamine?
1-N,4-N-bis[2-(aziridin-1-yl)ethyl]benzo[g]phthalazine-1,4-diamine has a molecular weight of 348.45 g/mol, XLogP of 2.24, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,4-N-bis[2-(aziridin-1-yl)ethyl]benzo[g]phthalazine-1,4-diamine is sourced from PubChem (CID 19811426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).