About 2-benzhydryl-N-[(2,5-difluorophenyl)methyl]-1-azabicyclo[2.2.2]octan-3-imine
2-benzhydryl-N-[(2,5-difluorophenyl)methyl]-1-azabicyclo[2.2.2]octan-3-imine (PubChem CID 19811860) has the molecular formula C27H26F2N2
and a molecular weight of 416.52 g/mol. Its IUPAC name is 2-benzhydryl-N-[(2,5-difluorophenyl)methyl]-1-azabicyclo[2.2.2]octan-3-imine.
Molecular Properties
| Compound Name | 2-benzhydryl-N-[(2,5-difluorophenyl)methyl]-1-azabicyclo[2.2.2]octan-3-imine |
| PubChem CID | 19811860 |
| Molecular Formula | C27H26F2N2 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | 2-benzhydryl-N-[(2,5-difluorophenyl)methyl]-1-azabicyclo[2.2.2]octan-3-imine |
| SMILES | Fc1ccc(F)c(C/N=C2\C3CCN(CC3)C2C(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C27H26F2N2/c28-23-11-12-24(29)22(17-23)18-30-26-21-13-15-31(16-14-21)27(26)25(19-7-3-1-4-8-19)20-9-5-2-6-10-20/h1-12,17,21,25,27H,13-16,18H2/b30-26+ |
| InChIKey | HWBDMVAIMYXNBK-URGPHPNLSA-N |
| XLogP | 5.83 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-benzhydryl-N-[(2,5-difluorophenyl)methyl]-1-azabicyclo[2.2.2]octan-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzhydryl-N-[(2,5-difluorophenyl)methyl]-1-azabicyclo[2.2.2]octan-3-imine?
The IUPAC name of 2-benzhydryl-N-[(2,5-difluorophenyl)methyl]-1-azabicyclo[2.2.2]octan-3-imine (CID 19811860) is 2-benzhydryl-N-[(2,5-difluorophenyl)methyl]-1-azabicyclo[2.2.2]octan-3-imine.
What is the SMILES notation for 2-benzhydryl-N-[(2,5-difluorophenyl)methyl]-1-azabicyclo[2.2.2]octan-3-imine?
The canonical SMILES for 2-benzhydryl-N-[(2,5-difluorophenyl)methyl]-1-azabicyclo[2.2.2]octan-3-imine is Fc1ccc(F)c(C/N=C2\C3CCN(CC3)C2C(c2ccccc2)c2ccccc2)c1.
What is the InChIKey of 2-benzhydryl-N-[(2,5-difluorophenyl)methyl]-1-azabicyclo[2.2.2]octan-3-imine?
The InChIKey is HWBDMVAIMYXNBK-URGPHPNLSA-N. The full InChI is InChI=1S/C27H26F2N2/c28-23-11-12-24(29)22(17-23)18-30-26-21-13-15-31(16-14-21)27(26)25(19-7-3-1-4-8-19)20-9-5-2-6-10-20/h1-12,17,21,25,27H,13-16,18H2/b30-26+.
What are the key properties of 2-benzhydryl-N-[(2,5-difluorophenyl)methyl]-1-azabicyclo[2.2.2]octan-3-imine?
2-benzhydryl-N-[(2,5-difluorophenyl)methyl]-1-azabicyclo[2.2.2]octan-3-imine has a molecular weight of 416.52 g/mol, XLogP of 5.83, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzhydryl-N-[(2,5-difluorophenyl)methyl]-1-azabicyclo[2.2.2]octan-3-imine is sourced from PubChem (CID 19811860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).