C5H4N4O2S — CID 19811943
5-(5-methyl-1,3,4-oxadiazol-2-yl)-3H-1,3,4-oxadiazole-2-thione (PubChem CID 19811943) has the molecular formula C5H4N4O2S and a molecular weight of 184.18 g/mol. Its IUPAC name is 5-(5-methyl-1,3,4-oxadiazol-2-yl)-3H-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-(5-methyl-1,3,4-oxadiazol-2-yl)-3H-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 19811943 |
| Molecular Formula | C5H4N4O2S |
| Molecular Weight | 184.18 g/mol |
| Exact Mass | 184.01 |
| IUPAC Name | 5-(5-methyl-1,3,4-oxadiazol-2-yl)-3H-1,3,4-oxadiazole-2-thione |
| SMILES | Cc1nnc(-c2n[nH]c(=S)o2)o1 |
| InChI | InChI=1S/C5H4N4O2S/c1-2-6-7-3(10-2)4-8-9-5(12)11-4/h1H3,(H,9,12) |
| InChIKey | KKGHEJFAIRUBRD-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 80.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.18 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|