C12H31NO8P2 — CID 19812120
3-[bis(1-hydroxyethyl)amino]pentan-3-ylphosphonic acid;[methoxy(methyl)phosphoryl]oxymethane (PubChem CID 19812120) has the molecular formula C12H31NO8P2 and a molecular weight of 379.33 g/mol. Its IUPAC name is 3-[bis(1-hydroxyethyl)amino]pentan-3-ylphosphonic acid;[methoxy(methyl)phosphoryl]oxymethane.
| Compound Name | 3-[bis(1-hydroxyethyl)amino]pentan-3-ylphosphonic acid;[methoxy(methyl)phosphoryl]oxymethane |
|---|---|
| PubChem CID | 19812120 |
| Molecular Formula | C12H31NO8P2 |
| Molecular Weight | 379.33 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 3-[bis(1-hydroxyethyl)amino]pentan-3-ylphosphonic acid;[methoxy(methyl)phosphoryl]oxymethane |
| SMILES | CCC(CC)(N(C(C)O)C(C)O)P(=O)(O)O.COP(C)(=O)OC |
| InChI | InChI=1S/C9H22NO5P.C3H9O3P/c1-5-9(6-2,16(13,14)15)10(7(3)11)8(4)12;1-5-7(3,4)6-2/h7-8,11-12H,5-6H2,1-4H3,(H2,13,14,15);1-3H3 |
| InChIKey | CAQSKMSVEMBHJO-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 136.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.33 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|