About 1-Oxobut-3-en-2-yl acetate
1-Oxobut-3-en-2-yl acetate (PubChem CID 19812396) has the molecular formula C6H8O3
and a molecular weight of 128.13 g/mol. Its IUPAC name is 1-oxobut-3-en-2-yl acetate.
Molecular Properties
| Compound Name | 1-Oxobut-3-en-2-yl acetate |
| PubChem CID | 19812396 |
| Molecular Formula | C6H8O3 |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.05 |
| IUPAC Name | 1-oxobut-3-en-2-yl acetate |
| SMILES | CC(=O)OC(C=C)C=O |
| InChI | InChI=1S/C6H8O3/c1-3-6(4-7)9-5(2)8/h3-4,6H,1H2,2H3 |
| InChIKey | NPWZJNGUJGYNBH-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | 128 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-Oxobut-3-en-2-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-Oxobut-3-en-2-yl acetate?
The IUPAC name of 1-Oxobut-3-en-2-yl acetate (CID 19812396) is 1-oxobut-3-en-2-yl acetate.
What is the SMILES notation for 1-Oxobut-3-en-2-yl acetate?
The canonical SMILES for 1-Oxobut-3-en-2-yl acetate is CC(=O)OC(C=C)C=O.
What is the InChIKey of 1-Oxobut-3-en-2-yl acetate?
The InChIKey is NPWZJNGUJGYNBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O3/c1-3-6(4-7)9-5(2)8/h3-4,6H,1H2,2H3.
What are the key properties of 1-Oxobut-3-en-2-yl acetate?
1-Oxobut-3-en-2-yl acetate has a molecular weight of 128.13 g/mol, XLogP of 0.50, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-Oxobut-3-en-2-yl acetate is sourced from PubChem (CID 19812396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).