About (E)-4,4-diethoxy-2-methylbut-2-enal
(E)-4,4-diethoxy-2-methylbut-2-enal (PubChem CID 19812402) has the molecular formula C9H16O3
and a molecular weight of 172.22 g/mol. Its IUPAC name is (E)-4,4-diethoxy-2-methylbut-2-enal.
Molecular Properties
| Compound Name | (E)-4,4-diethoxy-2-methylbut-2-enal |
| PubChem CID | 19812402 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | (E)-4,4-diethoxy-2-methylbut-2-enal |
| SMILES | CCOC(/C=C(\C)C=O)OCC |
| InChI | InChI=1S/C9H16O3/c1-4-11-9(12-5-2)6-8(3)7-10/h6-7,9H,4-5H2,1-3H3/b8-6+ |
| InChIKey | IAGSXCMFMPTMIF-SOFGYWHQSA-N |
| XLogP | 1.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-4,4-diethoxy-2-methylbut-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4,4-diethoxy-2-methylbut-2-enal?
The IUPAC name of (E)-4,4-diethoxy-2-methylbut-2-enal (CID 19812402) is (E)-4,4-diethoxy-2-methylbut-2-enal.
What is the SMILES notation for (E)-4,4-diethoxy-2-methylbut-2-enal?
The canonical SMILES for (E)-4,4-diethoxy-2-methylbut-2-enal is CCOC(/C=C(\C)C=O)OCC.
What is the InChIKey of (E)-4,4-diethoxy-2-methylbut-2-enal?
The InChIKey is IAGSXCMFMPTMIF-SOFGYWHQSA-N. The full InChI is InChI=1S/C9H16O3/c1-4-11-9(12-5-2)6-8(3)7-10/h6-7,9H,4-5H2,1-3H3/b8-6+.
What are the key properties of (E)-4,4-diethoxy-2-methylbut-2-enal?
(E)-4,4-diethoxy-2-methylbut-2-enal has a molecular weight of 172.22 g/mol, XLogP of 1.53, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4,4-diethoxy-2-methylbut-2-enal is sourced from PubChem (CID 19812402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).