About 4-chloro-3-(2,2,2-trifluoroethoxymethyl)aniline
4-chloro-3-(2,2,2-trifluoroethoxymethyl)aniline (PubChem CID 19812476) has the molecular formula C9H9ClF3NO
and a molecular weight of 239.62 g/mol. Its IUPAC name is 4-chloro-3-(2,2,2-trifluoroethoxymethyl)aniline.
Molecular Properties
| Compound Name | 4-chloro-3-(2,2,2-trifluoroethoxymethyl)aniline |
| PubChem CID | 19812476 |
| Molecular Formula | C9H9ClF3NO |
| Molecular Weight | 239.62 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | 4-chloro-3-(2,2,2-trifluoroethoxymethyl)aniline |
| SMILES | Nc1ccc(Cl)c(COCC(F)(F)F)c1 |
| InChI | InChI=1S/C9H9ClF3NO/c10-8-2-1-7(14)3-6(8)4-15-5-9(11,12)13/h1-3H,4-5,14H2 |
| InChIKey | ZMWNVGQTQZTQHC-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.62 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-3-(2,2,2-trifluoroethoxymethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-3-(2,2,2-trifluoroethoxymethyl)aniline?
The IUPAC name of 4-chloro-3-(2,2,2-trifluoroethoxymethyl)aniline (CID 19812476) is 4-chloro-3-(2,2,2-trifluoroethoxymethyl)aniline.
What is the SMILES notation for 4-chloro-3-(2,2,2-trifluoroethoxymethyl)aniline?
The canonical SMILES for 4-chloro-3-(2,2,2-trifluoroethoxymethyl)aniline is Nc1ccc(Cl)c(COCC(F)(F)F)c1.
What is the InChIKey of 4-chloro-3-(2,2,2-trifluoroethoxymethyl)aniline?
The InChIKey is ZMWNVGQTQZTQHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9ClF3NO/c10-8-2-1-7(14)3-6(8)4-15-5-9(11,12)13/h1-3H,4-5,14H2.
What are the key properties of 4-chloro-3-(2,2,2-trifluoroethoxymethyl)aniline?
4-chloro-3-(2,2,2-trifluoroethoxymethyl)aniline has a molecular weight of 239.62 g/mol, XLogP of 3.00, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-3-(2,2,2-trifluoroethoxymethyl)aniline is sourced from PubChem (CID 19812476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).