C11H9ClF7NO — CID 19812479
4-chloro-3-(2,2,3,3,4,4,4-heptafluorobutoxymethyl)aniline (PubChem CID 19812479) has the molecular formula C11H9ClF7NO and a molecular weight of 339.64 g/mol. Its IUPAC name is 4-chloro-3-(2,2,3,3,4,4,4-heptafluorobutoxymethyl)aniline.
| Compound Name | 4-chloro-3-(2,2,3,3,4,4,4-heptafluorobutoxymethyl)aniline |
|---|---|
| PubChem CID | 19812479 |
| Molecular Formula | C11H9ClF7NO |
| Molecular Weight | 339.64 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | 4-chloro-3-(2,2,3,3,4,4,4-heptafluorobutoxymethyl)aniline |
| SMILES | Nc1ccc(Cl)c(COCC(F)(F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C11H9ClF7NO/c12-8-2-1-7(20)3-6(8)4-21-5-9(13,14)10(15,16)11(17,18)19/h1-3H,4-5,20H2 |
| InChIKey | HIQZGVXWVIGXDQ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.64 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|