C24H29N3O3 — CID 19813058
4-[4-(4-hydroxy-4-phenylpiperidin-1-yl)butyl]-1,2-dihydro-1,4-benzodiazepine-3,5-dione (PubChem CID 19813058) has the molecular formula C24H29N3O3 and a molecular weight of 407.51 g/mol. Its IUPAC name is 4-[4-(4-hydroxy-4-phenylpiperidin-1-yl)butyl]-1,2-dihydro-1,4-benzodiazepine-3,5-dione.
| Compound Name | 4-[4-(4-hydroxy-4-phenylpiperidin-1-yl)butyl]-1,2-dihydro-1,4-benzodiazepine-3,5-dione |
|---|---|
| PubChem CID | 19813058 |
| Molecular Formula | C24H29N3O3 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | 4-[4-(4-hydroxy-4-phenylpiperidin-1-yl)butyl]-1,2-dihydro-1,4-benzodiazepine-3,5-dione |
| SMILES | O=C1CNc2ccccc2C(=O)N1CCCCN1CCC(O)(c2ccccc2)CC1 |
| InChI | InChI=1S/C24H29N3O3/c28-22-18-25-21-11-5-4-10-20(21)23(29)27(22)15-7-6-14-26-16-12-24(30,13-17-26)19-8-2-1-3-9-19/h1-5,8-11,25,30H,6-7,12-18H2 |
| InChIKey | UUPAARWFMFZBHL-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|