C5H9NO2S — CID 19813452
2-(1-hydroxyethyl)-1,3-thiazolidin-4-one (PubChem CID 19813452) has the molecular formula C5H9NO2S and a molecular weight of 147.20 g/mol. Its IUPAC name is 2-(1-hydroxyethyl)-1,3-thiazolidin-4-one.
| Compound Name | 2-(1-hydroxyethyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 19813452 |
| Molecular Formula | C5H9NO2S |
| Molecular Weight | 147.20 g/mol |
| Exact Mass | 147.04 |
| IUPAC Name | 2-(1-hydroxyethyl)-1,3-thiazolidin-4-one |
| SMILES | CC(O)C1NC(=O)CS1 |
| InChI | InChI=1S/C5H9NO2S/c1-3(7)5-6-4(8)2-9-5/h3,5,7H,2H2,1H3,(H,6,8) |
| InChIKey | YYZSEVDVHWOGEJ-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.20 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |