About 1,1-dimethoxyethane;hydrochloride
1,1-dimethoxyethane;hydrochloride (PubChem CID 19813467) has the molecular formula C4H11ClO2
and a molecular weight of 126.58 g/mol. Its IUPAC name is 1,1-dimethoxyethane;hydrochloride.
Molecular Properties
| Compound Name | 1,1-dimethoxyethane;hydrochloride |
| PubChem CID | 19813467 |
| Molecular Formula | C4H11ClO2 |
| Molecular Weight | 126.58 g/mol |
| Exact Mass | 126.04 |
| IUPAC Name | 1,1-dimethoxyethane;hydrochloride |
| SMILES | COC(C)OC.Cl |
| InChI | InChI=1S/C4H10O2.ClH/c1-4(5-2)6-3;/h4H,1-3H3;1H |
| InChIKey | NJBVZZSGBMPESV-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.58 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dimethoxyethane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dimethoxyethane;hydrochloride?
The IUPAC name of 1,1-dimethoxyethane;hydrochloride (CID 19813467) is 1,1-dimethoxyethane;hydrochloride.
What is the SMILES notation for 1,1-dimethoxyethane;hydrochloride?
The canonical SMILES for 1,1-dimethoxyethane;hydrochloride is COC(C)OC.Cl.
What is the InChIKey of 1,1-dimethoxyethane;hydrochloride?
The InChIKey is NJBVZZSGBMPESV-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O2.ClH/c1-4(5-2)6-3;/h4H,1-3H3;1H.
What are the key properties of 1,1-dimethoxyethane;hydrochloride?
1,1-dimethoxyethane;hydrochloride has a molecular weight of 126.58 g/mol, XLogP of 1.05, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dimethoxyethane;hydrochloride is sourced from PubChem (CID 19813467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).