About 9-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxy]-6-methoxypurin-2-amine
9-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxy]-6-methoxypurin-2-amine (PubChem CID 19813631) has the molecular formula C13H19N5O4
and a molecular weight of 309.33 g/mol. Its IUPAC name is 9-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxy]-6-methoxypurin-2-amine.
Molecular Properties
| Compound Name | 9-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxy]-6-methoxypurin-2-amine |
| PubChem CID | 19813631 |
| Molecular Formula | C13H19N5O4 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 9-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxy]-6-methoxypurin-2-amine |
| SMILES | COc1nc(N)nc2c1ncn2OCC1COC(C)(C)OC1 |
| InChI | InChI=1S/C13H19N5O4/c1-13(2)20-4-8(5-21-13)6-22-18-7-15-9-10(18)16-12(14)17-11(9)19-3/h7-8H,4-6H2,1-3H3,(H2,14,16,17) |
| InChIKey | CRAUTPNNLJQZCC-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 9-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxy]-6-methoxypurin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxy]-6-methoxypurin-2-amine?
The IUPAC name of 9-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxy]-6-methoxypurin-2-amine (CID 19813631) is 9-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxy]-6-methoxypurin-2-amine.
What is the SMILES notation for 9-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxy]-6-methoxypurin-2-amine?
The canonical SMILES for 9-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxy]-6-methoxypurin-2-amine is COc1nc(N)nc2c1ncn2OCC1COC(C)(C)OC1.
What is the InChIKey of 9-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxy]-6-methoxypurin-2-amine?
The InChIKey is CRAUTPNNLJQZCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N5O4/c1-13(2)20-4-8(5-21-13)6-22-18-7-15-9-10(18)16-12(14)17-11(9)19-3/h7-8H,4-6H2,1-3H3,(H2,14,16,17).
What are the key properties of 9-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxy]-6-methoxypurin-2-amine?
9-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxy]-6-methoxypurin-2-amine has a molecular weight of 309.33 g/mol, XLogP of 0.24, 4 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxy]-6-methoxypurin-2-amine is sourced from PubChem (CID 19813631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).