C11H13N3 — CID 19813965
1-[(1-ethenylcyclohexa-2,4-dien-1-yl)methyl]-1,2,4-triazole (PubChem CID 19813965) has the molecular formula C11H13N3 and a molecular weight of 187.25 g/mol. Its IUPAC name is 1-[(1-ethenylcyclohexa-2,4-dien-1-yl)methyl]-1,2,4-triazole.
| Compound Name | 1-[(1-ethenylcyclohexa-2,4-dien-1-yl)methyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 19813965 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | 1-[(1-ethenylcyclohexa-2,4-dien-1-yl)methyl]-1,2,4-triazole |
| SMILES | C=CC1(Cn2cncn2)C=CC=CC1 |
| InChI | InChI=1S/C11H13N3/c1-2-11(6-4-3-5-7-11)8-14-10-12-9-13-14/h2-6,9-10H,1,7-8H2 |
| InChIKey | VVRBYJUHTZUDRL-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|