C18H16ClF5N2O3 — CID 19813976
5-[(Z)-(3-chlorooxolan-2-ylidene)-cyanomethyl]-2-(difluoromethyl)-4-(2-methylpropyl)-6-(trifluoromethyl)pyridine-3-carboxylic acid (PubChem CID 19813976) has the molecular formula C18H16ClF5N2O3 and a molecular weight of 438.78 g/mol. Its IUPAC name is 5-[(Z)-(3-chlorooxolan-2-ylidene)-cyanomethyl]-2-(difluoromethyl)-4-(2-methylpropyl)-6-(trifluoromethyl)pyridine-3-carboxylic acid.
| Compound Name | 5-[(Z)-(3-chlorooxolan-2-ylidene)-cyanomethyl]-2-(difluoromethyl)-4-(2-methylpropyl)-6-(trifluoromethyl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 19813976 |
| Molecular Formula | C18H16ClF5N2O3 |
| Molecular Weight | 438.78 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | 5-[(Z)-(3-chlorooxolan-2-ylidene)-cyanomethyl]-2-(difluoromethyl)-4-(2-methylpropyl)-6-(trifluoromethyl)pyridine-3-carboxylic acid |
| SMILES | CC(C)Cc1c(C(=O)O)c(C(F)F)nc(C(F)(F)F)c1/C(C#N)=C1/OCCC1Cl |
| InChI | InChI=1S/C18H16ClF5N2O3/c1-7(2)5-8-11(9(6-25)14-10(19)3-4-29-14)15(18(22,23)24)26-13(16(20)21)12(8)17(27)28/h7,10,16H,3-5H2,1-2H3,(H,27,28)/b14-9+ |
| InChIKey | VICCWKHRQIFHPS-NTEUORMPSA-N |
| XLogP | 5.20 |
| TPSA | 83.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.78 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|