C18H36O6P2 — CID 19814146
[(5E,9E)-6,10,14-trimethyl-1-phosphonopentadeca-5,9-dienyl]phosphonic acid (PubChem CID 19814146) has the molecular formula C18H36O6P2 and a molecular weight of 410.43 g/mol. Its IUPAC name is [(5E,9E)-6,10,14-trimethyl-1-phosphonopentadeca-5,9-dienyl]phosphonic acid.
| Compound Name | [(5E,9E)-6,10,14-trimethyl-1-phosphonopentadeca-5,9-dienyl]phosphonic acid |
|---|---|
| PubChem CID | 19814146 |
| Molecular Formula | C18H36O6P2 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | [(5E,9E)-6,10,14-trimethyl-1-phosphonopentadeca-5,9-dienyl]phosphonic acid |
| SMILES | C/C(=C\CCCC(P(=O)(O)O)P(=O)(O)O)CC/C=C(\C)CCCC(C)C |
| InChI | InChI=1S/C18H36O6P2/c1-15(2)9-7-11-17(4)13-8-12-16(3)10-5-6-14-18(25(19,20)21)26(22,23)24/h10,13,15,18H,5-9,11-12,14H2,1-4H3,(H2,19,20,21)(H2,22,23,24)/b16-10+,17-13+ |
| InChIKey | VJOFOPFOWAPFKT-QKXOVSGLSA-N |
| XLogP | 5.34 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|