C5H9Cl4O3P — CID 19814535
1,1-dichloro-1-[1,1-dichloroethoxy(methyl)phosphoryl]oxyethane (PubChem CID 19814535) has the molecular formula C5H9Cl4O3P and a molecular weight of 289.91 g/mol. Its IUPAC name is 1,1-dichloro-1-[1,1-dichloroethoxy(methyl)phosphoryl]oxyethane.
| Compound Name | 1,1-dichloro-1-[1,1-dichloroethoxy(methyl)phosphoryl]oxyethane |
|---|---|
| PubChem CID | 19814535 |
| Molecular Formula | C5H9Cl4O3P |
| Molecular Weight | 289.91 g/mol |
| Exact Mass | 287.90 |
| IUPAC Name | 1,1-dichloro-1-[1,1-dichloroethoxy(methyl)phosphoryl]oxyethane |
| SMILES | CC(Cl)(Cl)OP(C)(=O)OC(C)(Cl)Cl |
| InChI | InChI=1S/C5H9Cl4O3P/c1-4(6,7)11-13(3,10)12-5(2,8)9/h1-3H3 |
| InChIKey | YKEJFRGSSWNMJU-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.91 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|