C6H8N2S — CID 19815256
2,3,3a,4-tetrahydro-1,2,3-benzothiadiazole (PubChem CID 19815256) has the molecular formula C6H8N2S and a molecular weight of 140.21 g/mol. Its IUPAC name is 2,3,3a,4-tetrahydro-1,2,3-benzothiadiazole.
| Compound Name | 2,3,3a,4-tetrahydro-1,2,3-benzothiadiazole |
|---|---|
| PubChem CID | 19815256 |
| Molecular Formula | C6H8N2S |
| Molecular Weight | 140.21 g/mol |
| Exact Mass | 140.04 |
| IUPAC Name | 2,3,3a,4-tetrahydro-1,2,3-benzothiadiazole |
| SMILES | C1=CCC2NNSC2=C1 |
| InChI | InChI=1S/C6H8N2S/c1-2-4-6-5(3-1)7-8-9-6/h1-2,4-5,7-8H,3H2 |
| InChIKey | KYWGCSAVRVWPBR-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.21 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|