C15H19NO4S2 — CID 19816115
3-[3-methoxy-4-(methoxymethoxy)phenyl]-1-(2-sulfanylidene-1,3-thiazolidin-3-yl)propan-1-one (PubChem CID 19816115) has the molecular formula C15H19NO4S2 and a molecular weight of 341.45 g/mol. Its IUPAC name is 3-[3-methoxy-4-(methoxymethoxy)phenyl]-1-(2-sulfanylidene-1,3-thiazolidin-3-yl)propan-1-one.
| Compound Name | 3-[3-methoxy-4-(methoxymethoxy)phenyl]-1-(2-sulfanylidene-1,3-thiazolidin-3-yl)propan-1-one |
|---|---|
| PubChem CID | 19816115 |
| Molecular Formula | C15H19NO4S2 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | 3-[3-methoxy-4-(methoxymethoxy)phenyl]-1-(2-sulfanylidene-1,3-thiazolidin-3-yl)propan-1-one |
| SMILES | COCOc1ccc(CCC(=O)N2CCSC2=S)cc1OC |
| InChI | InChI=1S/C15H19NO4S2/c1-18-10-20-12-5-3-11(9-13(12)19-2)4-6-14(17)16-7-8-22-15(16)21/h3,5,9H,4,6-8,10H2,1-2H3 |
| InChIKey | JQIFCPHVNCGDFV-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|