About N-[2,6-dichloro-4-[1-cyclohexyl-4-(diethylamino)-1-hydroxybutyl]phenyl]acetamide
N-[2,6-dichloro-4-[1-cyclohexyl-4-(diethylamino)-1-hydroxybutyl]phenyl]acetamide (PubChem CID 19816164) has the molecular formula C22H34Cl2N2O2
and a molecular weight of 429.43 g/mol. Its IUPAC name is N-[2,6-dichloro-4-[1-cyclohexyl-4-(diethylamino)-1-hydroxybutyl]phenyl]acetamide.
Molecular Properties
| Compound Name | N-[2,6-dichloro-4-[1-cyclohexyl-4-(diethylamino)-1-hydroxybutyl]phenyl]acetamide |
| PubChem CID | 19816164 |
| Molecular Formula | C22H34Cl2N2O2 |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | N-[2,6-dichloro-4-[1-cyclohexyl-4-(diethylamino)-1-hydroxybutyl]phenyl]acetamide |
| SMILES | CCN(CC)CCCC(O)(c1cc(Cl)c(NC(C)=O)c(Cl)c1)C1CCCCC1 |
| InChI | InChI=1S/C22H34Cl2N2O2/c1-4-26(5-2)13-9-12-22(28,17-10-7-6-8-11-17)18-14-19(23)21(20(24)15-18)25-16(3)27/h14-15,17,28H,4-13H2,1-3H3,(H,25,27) |
| InChIKey | JIMFYDMUKLHVSK-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2,6-dichloro-4-[1-cyclohexyl-4-(diethylamino)-1-hydroxybutyl]phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2,6-dichloro-4-[1-cyclohexyl-4-(diethylamino)-1-hydroxybutyl]phenyl]acetamide?
The IUPAC name of N-[2,6-dichloro-4-[1-cyclohexyl-4-(diethylamino)-1-hydroxybutyl]phenyl]acetamide (CID 19816164) is N-[2,6-dichloro-4-[1-cyclohexyl-4-(diethylamino)-1-hydroxybutyl]phenyl]acetamide.
What is the SMILES notation for N-[2,6-dichloro-4-[1-cyclohexyl-4-(diethylamino)-1-hydroxybutyl]phenyl]acetamide?
The canonical SMILES for N-[2,6-dichloro-4-[1-cyclohexyl-4-(diethylamino)-1-hydroxybutyl]phenyl]acetamide is CCN(CC)CCCC(O)(c1cc(Cl)c(NC(C)=O)c(Cl)c1)C1CCCCC1.
What is the InChIKey of N-[2,6-dichloro-4-[1-cyclohexyl-4-(diethylamino)-1-hydroxybutyl]phenyl]acetamide?
The InChIKey is JIMFYDMUKLHVSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H34Cl2N2O2/c1-4-26(5-2)13-9-12-22(28,17-10-7-6-8-11-17)18-14-19(23)21(20(24)15-18)25-16(3)27/h14-15,17,28H,4-13H2,1-3H3,(H,25,27).
What are the key properties of N-[2,6-dichloro-4-[1-cyclohexyl-4-(diethylamino)-1-hydroxybutyl]phenyl]acetamide?
N-[2,6-dichloro-4-[1-cyclohexyl-4-(diethylamino)-1-hydroxybutyl]phenyl]acetamide has a molecular weight of 429.43 g/mol, XLogP of 5.84, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2,6-dichloro-4-[1-cyclohexyl-4-(diethylamino)-1-hydroxybutyl]phenyl]acetamide is sourced from PubChem (CID 19816164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).