About 4-[(3-bromo-5-nitro-2-pyridinyl)oxy]-2,2-dimethyl-1,3-benzoxazine-6-carbonitrile
4-[(3-bromo-5-nitro-2-pyridinyl)oxy]-2,2-dimethyl-1,3-benzoxazine-6-carbonitrile (PubChem CID 19816990) has the molecular formula C16H11BrN4O4
and a molecular weight of 403.19 g/mol. Its IUPAC name is 4-[(3-bromo-5-nitro-2-pyridinyl)oxy]-2,2-dimethyl-1,3-benzoxazine-6-carbonitrile.
Molecular Properties
| Compound Name | 4-[(3-bromo-5-nitro-2-pyridinyl)oxy]-2,2-dimethyl-1,3-benzoxazine-6-carbonitrile |
| PubChem CID | 19816990 |
| Molecular Formula | C16H11BrN4O4 |
| Molecular Weight | 403.19 g/mol |
| Exact Mass | 402.00 |
| IUPAC Name | 4-[(3-bromo-5-nitro-2-pyridinyl)oxy]-2,2-dimethyl-1,3-benzoxazine-6-carbonitrile |
| SMILES | CC1(C)N=C(Oc2ncc([N+](=O)[O-])cc2Br)c2cc(C#N)ccc2O1 |
| InChI | InChI=1S/C16H11BrN4O4/c1-16(2)20-14(11-5-9(7-18)3-4-13(11)25-16)24-15-12(17)6-10(8-19-15)21(22)23/h3-6,8H,1-2H3 |
| InChIKey | CQFGIFCTYCCPQC-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 110.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.19 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3-bromo-5-nitro-2-pyridinyl)oxy]-2,2-dimethyl-1,3-benzoxazine-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3-bromo-5-nitro-2-pyridinyl)oxy]-2,2-dimethyl-1,3-benzoxazine-6-carbonitrile?
The IUPAC name of 4-[(3-bromo-5-nitro-2-pyridinyl)oxy]-2,2-dimethyl-1,3-benzoxazine-6-carbonitrile (CID 19816990) is 4-[(3-bromo-5-nitro-2-pyridinyl)oxy]-2,2-dimethyl-1,3-benzoxazine-6-carbonitrile.
What is the SMILES notation for 4-[(3-bromo-5-nitro-2-pyridinyl)oxy]-2,2-dimethyl-1,3-benzoxazine-6-carbonitrile?
The canonical SMILES for 4-[(3-bromo-5-nitro-2-pyridinyl)oxy]-2,2-dimethyl-1,3-benzoxazine-6-carbonitrile is CC1(C)N=C(Oc2ncc([N+](=O)[O-])cc2Br)c2cc(C#N)ccc2O1.
What is the InChIKey of 4-[(3-bromo-5-nitro-2-pyridinyl)oxy]-2,2-dimethyl-1,3-benzoxazine-6-carbonitrile?
The InChIKey is CQFGIFCTYCCPQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11BrN4O4/c1-16(2)20-14(11-5-9(7-18)3-4-13(11)25-16)24-15-12(17)6-10(8-19-15)21(22)23/h3-6,8H,1-2H3.
What are the key properties of 4-[(3-bromo-5-nitro-2-pyridinyl)oxy]-2,2-dimethyl-1,3-benzoxazine-6-carbonitrile?
4-[(3-bromo-5-nitro-2-pyridinyl)oxy]-2,2-dimethyl-1,3-benzoxazine-6-carbonitrile has a molecular weight of 403.19 g/mol, XLogP of 3.58, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3-bromo-5-nitro-2-pyridinyl)oxy]-2,2-dimethyl-1,3-benzoxazine-6-carbonitrile is sourced from PubChem (CID 19816990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).