C8H12F4O3 — CID 19817164
2,2-dimethyl-4-(1,1,2,2-tetrafluoroethoxymethyl)-1,3-dioxolane (PubChem CID 19817164) has the molecular formula C8H12F4O3 and a molecular weight of 232.17 g/mol. Its IUPAC name is 2,2-dimethyl-4-(1,1,2,2-tetrafluoroethoxymethyl)-1,3-dioxolane.
| Compound Name | 2,2-dimethyl-4-(1,1,2,2-tetrafluoroethoxymethyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 19817164 |
| Molecular Formula | C8H12F4O3 |
| Molecular Weight | 232.17 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 2,2-dimethyl-4-(1,1,2,2-tetrafluoroethoxymethyl)-1,3-dioxolane |
| SMILES | CC1(C)OCC(COC(F)(F)C(F)F)O1 |
| InChI | InChI=1S/C8H12F4O3/c1-7(2)13-3-5(15-7)4-14-8(11,12)6(9)10/h5-6H,3-4H2,1-2H3 |
| InChIKey | LOYDWJCFPKAJFW-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.17 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|