C19H26O6 — CID 19817256
2-methoxy-3,5-dimethylbenzene-1,4-diol;2-methoxy-3,5,6-trimethylbenzene-1,4-diol (PubChem CID 19817256) has the molecular formula C19H26O6 and a molecular weight of 350.41 g/mol. Its IUPAC name is 2-methoxy-3,5-dimethylbenzene-1,4-diol;2-methoxy-3,5,6-trimethylbenzene-1,4-diol.
| Compound Name | 2-methoxy-3,5-dimethylbenzene-1,4-diol;2-methoxy-3,5,6-trimethylbenzene-1,4-diol |
|---|---|
| PubChem CID | 19817256 |
| Molecular Formula | C19H26O6 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 2-methoxy-3,5-dimethylbenzene-1,4-diol;2-methoxy-3,5,6-trimethylbenzene-1,4-diol |
| SMILES | COc1c(C)c(O)c(C)c(C)c1O.COc1c(O)cc(C)c(O)c1C |
| InChI | InChI=1S/C10H14O3.C9H12O3/c1-5-6(2)9(12)10(13-4)7(3)8(5)11;1-5-4-7(10)9(12-3)6(2)8(5)11/h11-12H,1-4H3;4,10-11H,1-3H3 |
| InChIKey | RXUMJJZUFNGLFK-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|