About pentanamide;hydrochloride
pentanamide;hydrochloride (PubChem CID 19817493) has the molecular formula C5H12ClNO
and a molecular weight of 137.61 g/mol. Its IUPAC name is pentanamide;hydrochloride.
Molecular Properties
| Compound Name | pentanamide;hydrochloride |
| PubChem CID | 19817493 |
| Molecular Formula | C5H12ClNO |
| Molecular Weight | 137.61 g/mol |
| Exact Mass | 137.06 |
| IUPAC Name | pentanamide;hydrochloride |
| SMILES | CCCCC(N)=O.Cl |
| InChI | InChI=1S/C5H11NO.ClH/c1-2-3-4-5(6)7;/h2-4H2,1H3,(H2,6,7);1H |
| InChIKey | WIYDEVSKVYFPPV-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.61 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze pentanamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentanamide;hydrochloride?
The IUPAC name of pentanamide;hydrochloride (CID 19817493) is pentanamide;hydrochloride.
What is the SMILES notation for pentanamide;hydrochloride?
The canonical SMILES for pentanamide;hydrochloride is CCCCC(N)=O.Cl.
What is the InChIKey of pentanamide;hydrochloride?
The InChIKey is WIYDEVSKVYFPPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO.ClH/c1-2-3-4-5(6)7;/h2-4H2,1H3,(H2,6,7);1H.
What are the key properties of pentanamide;hydrochloride?
pentanamide;hydrochloride has a molecular weight of 137.61 g/mol, XLogP of 1.08, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for pentanamide;hydrochloride is sourced from PubChem (CID 19817493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).