About N-[4-acetyl-2-(1,3-thiazol-2-ylsulfonyl)phenyl]methanesulfonamide
N-[4-acetyl-2-(1,3-thiazol-2-ylsulfonyl)phenyl]methanesulfonamide (PubChem CID 19817702) has the molecular formula C12H12N2O5S3
and a molecular weight of 360.44 g/mol. Its IUPAC name is N-[4-acetyl-2-(1,3-thiazol-2-ylsulfonyl)phenyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[4-acetyl-2-(1,3-thiazol-2-ylsulfonyl)phenyl]methanesulfonamide |
| PubChem CID | 19817702 |
| Molecular Formula | C12H12N2O5S3 |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 359.99 |
| IUPAC Name | N-[4-acetyl-2-(1,3-thiazol-2-ylsulfonyl)phenyl]methanesulfonamide |
| SMILES | CC(=O)c1ccc(NS(C)(=O)=O)c(S(=O)(=O)c2nccs2)c1 |
| InChI | InChI=1S/C12H12N2O5S3/c1-8(15)9-3-4-10(14-21(2,16)17)11(7-9)22(18,19)12-13-5-6-20-12/h3-7,14H,1-2H3 |
| InChIKey | GLMWNWCKWMLKEC-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 110.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-[4-acetyl-2-(1,3-thiazol-2-ylsulfonyl)phenyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-acetyl-2-(1,3-thiazol-2-ylsulfonyl)phenyl]methanesulfonamide?
The IUPAC name of N-[4-acetyl-2-(1,3-thiazol-2-ylsulfonyl)phenyl]methanesulfonamide (CID 19817702) is N-[4-acetyl-2-(1,3-thiazol-2-ylsulfonyl)phenyl]methanesulfonamide.
What is the SMILES notation for N-[4-acetyl-2-(1,3-thiazol-2-ylsulfonyl)phenyl]methanesulfonamide?
The canonical SMILES for N-[4-acetyl-2-(1,3-thiazol-2-ylsulfonyl)phenyl]methanesulfonamide is CC(=O)c1ccc(NS(C)(=O)=O)c(S(=O)(=O)c2nccs2)c1.
What is the InChIKey of N-[4-acetyl-2-(1,3-thiazol-2-ylsulfonyl)phenyl]methanesulfonamide?
The InChIKey is GLMWNWCKWMLKEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O5S3/c1-8(15)9-3-4-10(14-21(2,16)17)11(7-9)22(18,19)12-13-5-6-20-12/h3-7,14H,1-2H3.
What are the key properties of N-[4-acetyl-2-(1,3-thiazol-2-ylsulfonyl)phenyl]methanesulfonamide?
N-[4-acetyl-2-(1,3-thiazol-2-ylsulfonyl)phenyl]methanesulfonamide has a molecular weight of 360.44 g/mol, XLogP of 1.55, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-acetyl-2-(1,3-thiazol-2-ylsulfonyl)phenyl]methanesulfonamide is sourced from PubChem (CID 19817702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).