About 4-phenylpiperidin-2-one
4-phenylpiperidin-2-one (PubChem CID 19817787) has the molecular formula C11H13NO
and a molecular weight of 175.23 g/mol. Its IUPAC name is 4-phenylpiperidin-2-one.
Molecular Properties
| Compound Name | 4-phenylpiperidin-2-one |
| PubChem CID | 19817787 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 4-phenylpiperidin-2-one |
| SMILES | O=C1CC(c2ccccc2)CCN1 |
| InChI | InChI=1S/C11H13NO/c13-11-8-10(6-7-12-11)9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H,12,13) |
| InChIKey | YZUKXJQGAVJSTK-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-phenylpiperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenylpiperidin-2-one?
The IUPAC name of 4-phenylpiperidin-2-one (CID 19817787) is 4-phenylpiperidin-2-one.
What is the SMILES notation for 4-phenylpiperidin-2-one?
The canonical SMILES for 4-phenylpiperidin-2-one is O=C1CC(c2ccccc2)CCN1.
What is the InChIKey of 4-phenylpiperidin-2-one?
The InChIKey is YZUKXJQGAVJSTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO/c13-11-8-10(6-7-12-11)9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H,12,13).
What are the key properties of 4-phenylpiperidin-2-one?
4-phenylpiperidin-2-one has a molecular weight of 175.23 g/mol, XLogP of 1.68, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenylpiperidin-2-one is sourced from PubChem (CID 19817787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).