About phenyl-bis(2,3,4-trimethylphenyl)phosphane
phenyl-bis(2,3,4-trimethylphenyl)phosphane (PubChem CID 19817893) has the molecular formula C24H27P
and a molecular weight of 346.45 g/mol. Its IUPAC name is phenyl-bis(2,3,4-trimethylphenyl)phosphane.
Molecular Properties
| Compound Name | phenyl-bis(2,3,4-trimethylphenyl)phosphane |
| PubChem CID | 19817893 |
| Molecular Formula | C24H27P |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | phenyl-bis(2,3,4-trimethylphenyl)phosphane |
| SMILES | Cc1ccc(P(c2ccccc2)c2ccc(C)c(C)c2C)c(C)c1C |
| InChI | InChI=1S/C24H27P/c1-16-12-14-23(20(5)18(16)3)25(22-10-8-7-9-11-22)24-15-13-17(2)19(4)21(24)6/h7-15H,1-6H3 |
| InChIKey | OHUBTNCFAYBUKT-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze phenyl-bis(2,3,4-trimethylphenyl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl-bis(2,3,4-trimethylphenyl)phosphane?
The IUPAC name of phenyl-bis(2,3,4-trimethylphenyl)phosphane (CID 19817893) is phenyl-bis(2,3,4-trimethylphenyl)phosphane.
What is the SMILES notation for phenyl-bis(2,3,4-trimethylphenyl)phosphane?
The canonical SMILES for phenyl-bis(2,3,4-trimethylphenyl)phosphane is Cc1ccc(P(c2ccccc2)c2ccc(C)c(C)c2C)c(C)c1C.
What is the InChIKey of phenyl-bis(2,3,4-trimethylphenyl)phosphane?
The InChIKey is OHUBTNCFAYBUKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H27P/c1-16-12-14-23(20(5)18(16)3)25(22-10-8-7-9-11-22)24-15-13-17(2)19(4)21(24)6/h7-15H,1-6H3.
What are the key properties of phenyl-bis(2,3,4-trimethylphenyl)phosphane?
phenyl-bis(2,3,4-trimethylphenyl)phosphane has a molecular weight of 346.45 g/mol, XLogP of 5.30, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl-bis(2,3,4-trimethylphenyl)phosphane is sourced from PubChem (CID 19817893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).