About 2-(chloromethyl)-N,N-diethyl-1-phenylcyclopropane-1-carboxamide
2-(chloromethyl)-N,N-diethyl-1-phenylcyclopropane-1-carboxamide (PubChem CID 19818000) has the molecular formula C15H20ClNO
and a molecular weight of 265.78 g/mol. Its IUPAC name is 2-(chloromethyl)-N,N-diethyl-1-phenylcyclopropane-1-carboxamide.
Molecular Properties
| Compound Name | 2-(chloromethyl)-N,N-diethyl-1-phenylcyclopropane-1-carboxamide |
| PubChem CID | 19818000 |
| Molecular Formula | C15H20ClNO |
| Molecular Weight | 265.78 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 2-(chloromethyl)-N,N-diethyl-1-phenylcyclopropane-1-carboxamide |
| SMILES | CCN(CC)C(=O)C1(c2ccccc2)CC1CCl |
| InChI | InChI=1S/C15H20ClNO/c1-3-17(4-2)14(18)15(10-13(15)11-16)12-8-6-5-7-9-12/h5-9,13H,3-4,10-11H2,1-2H3 |
| InChIKey | PFFIHIRGBGNQMV-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.78 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(chloromethyl)-N,N-diethyl-1-phenylcyclopropane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(chloromethyl)-N,N-diethyl-1-phenylcyclopropane-1-carboxamide?
The IUPAC name of 2-(chloromethyl)-N,N-diethyl-1-phenylcyclopropane-1-carboxamide (CID 19818000) is 2-(chloromethyl)-N,N-diethyl-1-phenylcyclopropane-1-carboxamide.
What is the SMILES notation for 2-(chloromethyl)-N,N-diethyl-1-phenylcyclopropane-1-carboxamide?
The canonical SMILES for 2-(chloromethyl)-N,N-diethyl-1-phenylcyclopropane-1-carboxamide is CCN(CC)C(=O)C1(c2ccccc2)CC1CCl.
What is the InChIKey of 2-(chloromethyl)-N,N-diethyl-1-phenylcyclopropane-1-carboxamide?
The InChIKey is PFFIHIRGBGNQMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20ClNO/c1-3-17(4-2)14(18)15(10-13(15)11-16)12-8-6-5-7-9-12/h5-9,13H,3-4,10-11H2,1-2H3.
What are the key properties of 2-(chloromethyl)-N,N-diethyl-1-phenylcyclopropane-1-carboxamide?
2-(chloromethyl)-N,N-diethyl-1-phenylcyclopropane-1-carboxamide has a molecular weight of 265.78 g/mol, XLogP of 3.05, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(chloromethyl)-N,N-diethyl-1-phenylcyclopropane-1-carboxamide is sourced from PubChem (CID 19818000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).