C25H46N2O4 — CID 19818848
diethyl 2,2-bis(2,2,6,6-tetramethylpiperidin-4-yl)propanedioate (PubChem CID 19818848) has the molecular formula C25H46N2O4 and a molecular weight of 438.65 g/mol. Its IUPAC name is diethyl 2,2-bis(2,2,6,6-tetramethylpiperidin-4-yl)propanedioate.
| Compound Name | diethyl 2,2-bis(2,2,6,6-tetramethylpiperidin-4-yl)propanedioate |
|---|---|
| PubChem CID | 19818848 |
| Molecular Formula | C25H46N2O4 |
| Molecular Weight | 438.65 g/mol |
| Exact Mass | 438.35 |
| IUPAC Name | diethyl 2,2-bis(2,2,6,6-tetramethylpiperidin-4-yl)propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)(C1CC(C)(C)NC(C)(C)C1)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C25H46N2O4/c1-11-30-19(28)25(20(29)31-12-2,17-13-21(3,4)26-22(5,6)14-17)18-15-23(7,8)27-24(9,10)16-18/h17-18,26-27H,11-16H2,1-10H3 |
| InChIKey | SNSOQUSPEDCVOQ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.65 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|