About [4-hydroxy-3-(3-hydroxy-3-methylpent-4-enyl)-2,5,6-trimethylphenyl] acetate
[4-hydroxy-3-(3-hydroxy-3-methylpent-4-enyl)-2,5,6-trimethylphenyl] acetate (PubChem CID 19819043) has the molecular formula C17H24O4
and a molecular weight of 292.38 g/mol. Its IUPAC name is [4-hydroxy-3-(3-hydroxy-3-methylpent-4-enyl)-2,5,6-trimethylphenyl] acetate.
Molecular Properties
| Compound Name | [4-hydroxy-3-(3-hydroxy-3-methylpent-4-enyl)-2,5,6-trimethylphenyl] acetate |
| PubChem CID | 19819043 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | [4-hydroxy-3-(3-hydroxy-3-methylpent-4-enyl)-2,5,6-trimethylphenyl] acetate |
| SMILES | C=CC(C)(O)CCc1c(C)c(OC(C)=O)c(C)c(C)c1O |
| InChI | InChI=1S/C17H24O4/c1-7-17(6,20)9-8-14-12(4)16(21-13(5)18)11(3)10(2)15(14)19/h7,19-20H,1,8-9H2,2-6H3 |
| InChIKey | DPTXTJDZMQYPRH-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-hydroxy-3-(3-hydroxy-3-methylpent-4-enyl)-2,5,6-trimethylphenyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-hydroxy-3-(3-hydroxy-3-methylpent-4-enyl)-2,5,6-trimethylphenyl] acetate?
The IUPAC name of [4-hydroxy-3-(3-hydroxy-3-methylpent-4-enyl)-2,5,6-trimethylphenyl] acetate (CID 19819043) is [4-hydroxy-3-(3-hydroxy-3-methylpent-4-enyl)-2,5,6-trimethylphenyl] acetate.
What is the SMILES notation for [4-hydroxy-3-(3-hydroxy-3-methylpent-4-enyl)-2,5,6-trimethylphenyl] acetate?
The canonical SMILES for [4-hydroxy-3-(3-hydroxy-3-methylpent-4-enyl)-2,5,6-trimethylphenyl] acetate is C=CC(C)(O)CCc1c(C)c(OC(C)=O)c(C)c(C)c1O.
What is the InChIKey of [4-hydroxy-3-(3-hydroxy-3-methylpent-4-enyl)-2,5,6-trimethylphenyl] acetate?
The InChIKey is DPTXTJDZMQYPRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24O4/c1-7-17(6,20)9-8-14-12(4)16(21-13(5)18)11(3)10(2)15(14)19/h7,19-20H,1,8-9H2,2-6H3.
What are the key properties of [4-hydroxy-3-(3-hydroxy-3-methylpent-4-enyl)-2,5,6-trimethylphenyl] acetate?
[4-hydroxy-3-(3-hydroxy-3-methylpent-4-enyl)-2,5,6-trimethylphenyl] acetate has a molecular weight of 292.38 g/mol, XLogP of 3.11, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-hydroxy-3-(3-hydroxy-3-methylpent-4-enyl)-2,5,6-trimethylphenyl] acetate is sourced from PubChem (CID 19819043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).