About methanesulfonate;tetraethylazanium
methanesulfonate;tetraethylazanium (PubChem CID 19819108) has the molecular formula C9H23NO3S
and a molecular weight of 225.35 g/mol. Its IUPAC name is methanesulfonate;tetraethylazanium.
Molecular Properties
| Compound Name | methanesulfonate;tetraethylazanium |
| PubChem CID | 19819108 |
| Molecular Formula | C9H23NO3S |
| Molecular Weight | 225.35 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | methanesulfonate;tetraethylazanium |
| SMILES | CC[N+](CC)(CC)CC.CS(=O)(=O)[O-] |
| InChI | InChI=1S/C8H20N.CH4O3S/c1-5-9(6-2,7-3)8-4;1-5(2,3)4/h5-8H2,1-4H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | BXXOINVHLUGMHI-UHFFFAOYSA-M |
| XLogP | 1.04 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.35 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze methanesulfonate;tetraethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanesulfonate;tetraethylazanium?
The IUPAC name of methanesulfonate;tetraethylazanium (CID 19819108) is methanesulfonate;tetraethylazanium.
What is the SMILES notation for methanesulfonate;tetraethylazanium?
The canonical SMILES for methanesulfonate;tetraethylazanium is CC[N+](CC)(CC)CC.CS(=O)(=O)[O-].
What is the InChIKey of methanesulfonate;tetraethylazanium?
The InChIKey is BXXOINVHLUGMHI-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H20N.CH4O3S/c1-5-9(6-2,7-3)8-4;1-5(2,3)4/h5-8H2,1-4H3;1H3,(H,2,3,4)/q+1;/p-1.
What are the key properties of methanesulfonate;tetraethylazanium?
methanesulfonate;tetraethylazanium has a molecular weight of 225.35 g/mol, XLogP of 1.04, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methanesulfonate;tetraethylazanium is sourced from PubChem (CID 19819108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).