C18H36N2S2 — CID 19819300
2,2,3,3-tetrapropylhexanedithioamide (PubChem CID 19819300) has the molecular formula C18H36N2S2 and a molecular weight of 344.63 g/mol. Its IUPAC name is 2,2,3,3-tetrapropylhexanedithioamide.
| Compound Name | 2,2,3,3-tetrapropylhexanedithioamide |
|---|---|
| PubChem CID | 19819300 |
| Molecular Formula | C18H36N2S2 |
| Molecular Weight | 344.63 g/mol |
| Exact Mass | 344.23 |
| IUPAC Name | 2,2,3,3-tetrapropylhexanedithioamide |
| SMILES | CCCC(CCC)(CCC(N)=S)C(CCC)(CCC)C(N)=S |
| InChI | InChI=1S/C18H36N2S2/c1-5-10-17(11-6-2,14-9-15(19)21)18(12-7-3,13-8-4)16(20)22/h5-14H2,1-4H3,(H2,19,21)(H2,20,22) |
| InChIKey | YGJOMFOUPLBWCG-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.63 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|