About N-methylidenehydroxylamine;2-oxobutanal
N-methylidenehydroxylamine;2-oxobutanal (PubChem CID 19820227) has the molecular formula C5H9NO3
and a molecular weight of 131.13 g/mol. Its IUPAC name is N-methylidenehydroxylamine;2-oxobutanal.
Molecular Properties
| Compound Name | N-methylidenehydroxylamine;2-oxobutanal |
| PubChem CID | 19820227 |
| Molecular Formula | C5H9NO3 |
| Molecular Weight | 131.13 g/mol |
| Exact Mass | 131.06 |
| IUPAC Name | N-methylidenehydroxylamine;2-oxobutanal |
| SMILES | C=NO.CCC(=O)C=O |
| InChI | InChI=1S/C4H6O2.CH3NO/c1-2-4(6)3-5;1-2-3/h3H,2H2,1H3;3H,1H2 |
| InChIKey | LDIOLXOZJWXZEI-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.13 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methylidenehydroxylamine;2-oxobutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylidenehydroxylamine;2-oxobutanal?
The IUPAC name of N-methylidenehydroxylamine;2-oxobutanal (CID 19820227) is N-methylidenehydroxylamine;2-oxobutanal.
What is the SMILES notation for N-methylidenehydroxylamine;2-oxobutanal?
The canonical SMILES for N-methylidenehydroxylamine;2-oxobutanal is C=NO.CCC(=O)C=O.
What is the InChIKey of N-methylidenehydroxylamine;2-oxobutanal?
The InChIKey is LDIOLXOZJWXZEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O2.CH3NO/c1-2-4(6)3-5;1-2-3/h3H,2H2,1H3;3H,1H2.
What are the key properties of N-methylidenehydroxylamine;2-oxobutanal?
N-methylidenehydroxylamine;2-oxobutanal has a molecular weight of 131.13 g/mol, XLogP of 0.24, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylidenehydroxylamine;2-oxobutanal is sourced from PubChem (CID 19820227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).