About CID 19820277
CID 19820277 (PubChem CID 19820277) has the molecular formula C10H23O2Si
and a molecular weight of 203.38 g/mol.
Molecular Properties
| Compound Name | CID 19820277 |
| PubChem CID | 19820277 |
| Molecular Formula | C10H23O2Si |
| Molecular Weight | 203.38 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | — |
| SMILES | COC(OC)[Si](CC(C)C)C(C)C |
| InChI | InChI=1S/C10H23O2Si/c1-8(2)7-13(9(3)4)10(11-5)12-6/h8-10H,7H2,1-6H3 |
| InChIKey | ZGGYUEMXMRJXKJ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.38 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze CID 19820277 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 19820277?
The IUPAC name of CID 19820277 (CID 19820277) is not available.
What is the SMILES notation for CID 19820277?
The canonical SMILES for CID 19820277 is COC(OC)[Si](CC(C)C)C(C)C.
What is the InChIKey of CID 19820277?
The InChIKey is ZGGYUEMXMRJXKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23O2Si/c1-8(2)7-13(9(3)4)10(11-5)12-6/h8-10H,7H2,1-6H3.
What are the key properties of CID 19820277?
CID 19820277 has a molecular weight of 203.38 g/mol, XLogP of 2.71, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 19820277 is sourced from PubChem (CID 19820277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).