C22H30ClN3 — CID 19820468
N-(4,4-diphenylbutyl)-1,4,5,6,7,8-hexahydro-1,3-diazocin-2-amine;hydrochloride (PubChem CID 19820468) has the molecular formula C22H30ClN3 and a molecular weight of 371.96 g/mol. Its IUPAC name is N-(4,4-diphenylbutyl)-1,4,5,6,7,8-hexahydro-1,3-diazocin-2-amine;hydrochloride.
| Compound Name | N-(4,4-diphenylbutyl)-1,4,5,6,7,8-hexahydro-1,3-diazocin-2-amine;hydrochloride |
|---|---|
| PubChem CID | 19820468 |
| Molecular Formula | C22H30ClN3 |
| Molecular Weight | 371.96 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | N-(4,4-diphenylbutyl)-1,4,5,6,7,8-hexahydro-1,3-diazocin-2-amine;hydrochloride |
| SMILES | Cl.c1ccc(C(CCCN/C2=N/CCCCCN2)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H29N3.ClH/c1-4-11-19(12-5-1)21(20-13-6-2-7-14-20)15-10-18-25-22-23-16-8-3-9-17-24-22;/h1-2,4-7,11-14,21H,3,8-10,15-18H2,(H2,23,24,25);1H |
| InChIKey | ZIYQNXCKSAAGKD-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.96 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|